C20H20NO5P — CID 66820502
(2S)-2-amino-3-naphthalen-1-yl-3-[2-(phosphonomethyl)phenyl]propanoic acid (PubChem CID 66820502) has the molecular formula C20H20NO5P and a molecular weight of 385.36 g/mol. Its IUPAC name is (2S)-2-amino-3-naphthalen-1-yl-3-[2-(phosphonomethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-naphthalen-1-yl-3-[2-(phosphonomethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 66820502 |
| Molecular Formula | C20H20NO5P |
| Molecular Weight | 385.36 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (2S)-2-amino-3-naphthalen-1-yl-3-[2-(phosphonomethyl)phenyl]propanoic acid |
| SMILES | N[C@H](C(=O)O)C(c1ccccc1CP(=O)(O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H20NO5P/c21-19(20(22)23)18(16-10-4-2-7-14(16)12-27(24,25)26)17-11-5-8-13-6-1-3-9-15(13)17/h1-11,18-19H,12,21H2,(H,22,23)(H2,24,25,26)/t18?,19-/m0/s1 |
| InChIKey | YDTQZXFKPOZIBO-GGYWPGCISA-N |
| XLogP | 3.06 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|