C11H17N2O5P — CID 57074206
2-amino-4-[2-[amino(phosphono)methyl]phenyl]butanoic acid (PubChem CID 57074206) has the molecular formula C11H17N2O5P and a molecular weight of 288.24 g/mol. Its IUPAC name is 2-amino-4-[2-[amino(phosphono)methyl]phenyl]butanoic acid.
| Compound Name | 2-amino-4-[2-[amino(phosphono)methyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 57074206 |
| Molecular Formula | C11H17N2O5P |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-amino-4-[2-[amino(phosphono)methyl]phenyl]butanoic acid |
| SMILES | NC(CCc1ccccc1C(N)P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C11H17N2O5P/c12-9(11(14)15)6-5-7-3-1-2-4-8(7)10(13)19(16,17)18/h1-4,9-10H,5-6,12-13H2,(H,14,15)(H2,16,17,18) |
| InChIKey | CELRHRDUQIUGSO-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|