C20H18NO4P — CID 11233947
[1-naphthalen-1-yl-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]phosphonic acid (PubChem CID 11233947) has the molecular formula C20H18NO4P and a molecular weight of 367.34 g/mol. Its IUPAC name is [1-naphthalen-1-yl-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]phosphonic acid.
| Compound Name | [1-naphthalen-1-yl-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 11233947 |
| Molecular Formula | C20H18NO4P |
| Molecular Weight | 367.34 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | [1-naphthalen-1-yl-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]phosphonic acid |
| SMILES | O=C(N/C=C/c1ccccc1)C(c1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C20H18NO4P/c22-20(21-14-13-15-7-2-1-3-8-15)19(26(23,24)25)18-12-6-10-16-9-4-5-11-17(16)18/h1-14,19H,(H,21,22)(H2,23,24,25)/b14-13+ |
| InChIKey | CLQAHGHEUIHTDL-BUHFOSPRSA-N |
| XLogP | 3.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|