C24H20NO6P — CID 66677543
[2-[(3-methoxycarbonylnaphthalen-2-yl)amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 66677543) has the molecular formula C24H20NO6P and a molecular weight of 449.40 g/mol. Its IUPAC name is [2-[(3-methoxycarbonylnaphthalen-2-yl)amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[(3-methoxycarbonylnaphthalen-2-yl)amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 66677543 |
| Molecular Formula | C24H20NO6P |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | [2-[(3-methoxycarbonylnaphthalen-2-yl)amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | COC(=O)c1cc2ccccc2cc1NC(=O)C(c1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C24H20NO6P/c1-31-24(27)20-13-16-8-2-3-9-17(16)14-21(20)25-23(26)22(32(28,29)30)19-12-6-10-15-7-4-5-11-18(15)19/h2-14,22H,1H3,(H,25,26)(H2,28,29,30) |
| InChIKey | PCBGTEXNBUZHFR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|