C21H17N2O4P — CID 25264648
[2-(isoquinolin-3-ylamino)-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 25264648) has the molecular formula C21H17N2O4P and a molecular weight of 392.35 g/mol. Its IUPAC name is [2-(isoquinolin-3-ylamino)-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-(isoquinolin-3-ylamino)-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25264648 |
| Molecular Formula | C21H17N2O4P |
| Molecular Weight | 392.35 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-(isoquinolin-3-ylamino)-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | O=C(Nc1cc2ccccc2cn1)C(c1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C21H17N2O4P/c24-21(23-19-12-15-7-1-2-8-16(15)13-22-19)20(28(25,26)27)18-11-5-9-14-6-3-4-10-17(14)18/h1-13,20H,(H,22,23,24)(H2,25,26,27) |
| InChIKey | DNRRUBNNABOQQD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|