C30H33N2O6P — CID 66889562
[2-[[3-[2-methoxy-2-oxo-1-(pentylamino)ethyl]naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 66889562) has the molecular formula C30H33N2O6P and a molecular weight of 548.58 g/mol. Its IUPAC name is [2-[[3-[2-methoxy-2-oxo-1-(pentylamino)ethyl]naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[[3-[2-methoxy-2-oxo-1-(pentylamino)ethyl]naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 66889562 |
| Molecular Formula | C30H33N2O6P |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | [2-[[3-[2-methoxy-2-oxo-1-(pentylamino)ethyl]naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | CCCCCNC(C(=O)OC)c1cc2ccccc2cc1NC(=O)C(c1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C30H33N2O6P/c1-3-4-9-17-31-27(30(34)38-2)25-18-21-12-5-6-13-22(21)19-26(25)32-29(33)28(39(35,36)37)24-16-10-14-20-11-7-8-15-23(20)24/h5-8,10-16,18-19,27-28,31H,3-4,9,17H2,1-2H3,(H,32,33)(H2,35,36,37) |
| InChIKey | JAWKENVEVGRFLD-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|