C30H25N2O5P — CID 66678345
[2-[[3-(benzylcarbamoyl)naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 66678345) has the molecular formula C30H25N2O5P and a molecular weight of 524.51 g/mol. Its IUPAC name is [2-[[3-(benzylcarbamoyl)naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[[3-(benzylcarbamoyl)naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 66678345 |
| Molecular Formula | C30H25N2O5P |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | [2-[[3-(benzylcarbamoyl)naphthalen-2-yl]amino]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | O=C(NCc1ccccc1)c1cc2ccccc2cc1NC(=O)C(c1cccc2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C30H25N2O5P/c33-29(31-19-20-9-2-1-3-10-20)26-17-22-12-4-5-13-23(22)18-27(26)32-30(34)28(38(35,36)37)25-16-8-14-21-11-6-7-15-24(21)25/h1-18,28H,19H2,(H,31,33)(H,32,34)(H2,35,36,37) |
| InChIKey | MCEKYOUSZXXFHZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|