C31H31N2O6P — CID 67095650
[2-[3-[(1-acetylpiperidin-4-yl)methylcarbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 67095650) has the molecular formula C31H31N2O6P and a molecular weight of 558.57 g/mol. Its IUPAC name is [2-[3-[(1-acetylpiperidin-4-yl)methylcarbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[3-[(1-acetylpiperidin-4-yl)methylcarbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 67095650 |
| Molecular Formula | C31H31N2O6P |
| Molecular Weight | 558.57 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | [2-[3-[(1-acetylpiperidin-4-yl)methylcarbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | CC(=O)N1CCC(CNC(=O)c2cc3ccccc3cc2C(=O)C(c2cccc3ccccc23)P(=O)(O)O)CC1 |
| InChI | InChI=1S/C31H31N2O6P/c1-20(34)33-15-13-21(14-16-33)19-32-31(36)28-18-24-9-3-2-8-23(24)17-27(28)29(35)30(40(37,38)39)26-12-6-10-22-7-4-5-11-25(22)26/h2-12,17-18,21,30H,13-16,19H2,1H3,(H,32,36)(H2,37,38,39) |
| InChIKey | CPSQHVLAQDMRLI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|