C15H22ClN3O2 — CID 119945298
N-[(1-acetylpiperidin-4-yl)methyl]-2-aminobenzamide;hydrochloride (PubChem CID 119945298) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[(1-acetylpiperidin-4-yl)methyl]-2-aminobenzamide;hydrochloride.
| Compound Name | N-[(1-acetylpiperidin-4-yl)methyl]-2-aminobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119945298 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | N-[(1-acetylpiperidin-4-yl)methyl]-2-aminobenzamide;hydrochloride |
| SMILES | CC(=O)N1CCC(CNC(=O)c2ccccc2N)CC1.Cl |
| InChI | InChI=1S/C15H21N3O2.ClH/c1-11(19)18-8-6-12(7-9-18)10-17-15(20)13-4-2-3-5-14(13)16;/h2-5,12H,6-10,16H2,1H3,(H,17,20);1H |
| InChIKey | QBBRBHMYTSANMW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|