C16H21ClN4O2 — CID 121325886
N-[(1-acetylpiperidin-4-yl)methyl]-3-amino-5-chloro-2-methanimidoylbenzamide (PubChem CID 121325886) has the molecular formula C16H21ClN4O2 and a molecular weight of 336.82 g/mol. Its IUPAC name is N-[(1-acetylpiperidin-4-yl)methyl]-3-amino-5-chloro-2-methanimidoylbenzamide.
| Compound Name | N-[(1-acetylpiperidin-4-yl)methyl]-3-amino-5-chloro-2-methanimidoylbenzamide |
|---|---|
| PubChem CID | 121325886 |
| Molecular Formula | C16H21ClN4O2 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | N-[(1-acetylpiperidin-4-yl)methyl]-3-amino-5-chloro-2-methanimidoylbenzamide |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1C(=O)NCC1CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C16H21ClN4O2/c1-10(22)21-4-2-11(3-5-21)9-20-16(23)13-6-12(17)7-15(19)14(13)8-18/h6-8,11,18H,2-5,9,19H2,1H3,(H,20,23)/b18-8+ |
| InChIKey | QFPGUHKKDGOXSE-QGMBQPNBSA-N |
| XLogP | 1.91 |
| TPSA | 99.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|