C30H30NO5P — CID 10301386
[2-[3-[cyclohexyl(methyl)carbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid (PubChem CID 10301386) has the molecular formula C30H30NO5P and a molecular weight of 515.55 g/mol. Its IUPAC name is [2-[3-[cyclohexyl(methyl)carbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid.
| Compound Name | [2-[3-[cyclohexyl(methyl)carbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 10301386 |
| Molecular Formula | C30H30NO5P |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | [2-[3-[cyclohexyl(methyl)carbamoyl]naphthalen-2-yl]-1-naphthalen-1-yl-2-oxoethyl]phosphonic acid |
| SMILES | CN(C(=O)c1cc2ccccc2cc1C(=O)C(c1cccc2ccccc12)P(=O)(O)O)C1CCCCC1 |
| InChI | InChI=1S/C30H30NO5P/c1-31(23-14-3-2-4-15-23)30(33)27-19-22-12-6-5-11-21(22)18-26(27)28(32)29(37(34,35)36)25-17-9-13-20-10-7-8-16-24(20)25/h5-13,16-19,23,29H,2-4,14-15H2,1H3,(H2,34,35,36) |
| InChIKey | FSLBGHJRBLKWAU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|