C20H17N2O4P — CID 11303525
[1-(1H-indol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid (PubChem CID 11303525) has the molecular formula C20H17N2O4P and a molecular weight of 380.34 g/mol. Its IUPAC name is [1-(1H-indol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-(1H-indol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 11303525 |
| Molecular Formula | C20H17N2O4P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | [1-(1H-indol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
| SMILES | O=C(Nc1ccc2ccccc2c1)C(c1c[nH]c2ccccc12)P(=O)(O)O |
| InChI | InChI=1S/C20H17N2O4P/c23-20(22-15-10-9-13-5-1-2-6-14(13)11-15)19(27(24,25)26)17-12-21-18-8-4-3-7-16(17)18/h1-12,19,21H,(H,22,23)(H2,24,25,26) |
| InChIKey | BTRJCBFYYHFVKD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|