C20H15ClNO5P — CID 25066972
[1-(5-chloro-1-benzofuran-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid (PubChem CID 25066972) has the molecular formula C20H15ClNO5P and a molecular weight of 415.77 g/mol. Its IUPAC name is [1-(5-chloro-1-benzofuran-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-(5-chloro-1-benzofuran-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25066972 |
| Molecular Formula | C20H15ClNO5P |
| Molecular Weight | 415.77 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | [1-(5-chloro-1-benzofuran-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
| SMILES | O=C(Nc1ccc2ccccc2c1)C(c1coc2ccc(Cl)cc12)P(=O)(O)O |
| InChI | InChI=1S/C20H15ClNO5P/c21-14-6-8-18-16(10-14)17(11-27-18)19(28(24,25)26)20(23)22-15-7-5-12-3-1-2-4-13(12)9-15/h1-11,19H,(H,22,23)(H2,24,25,26) |
| InChIKey | SCTWAQVTIGNHLC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|