C21H18ClN2O4P — CID 25264110
[1-(7-chloro-1-methylindol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid (PubChem CID 25264110) has the molecular formula C21H18ClN2O4P and a molecular weight of 428.81 g/mol. Its IUPAC name is [1-(7-chloro-1-methylindol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid.
| Compound Name | [1-(7-chloro-1-methylindol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
|---|---|
| PubChem CID | 25264110 |
| Molecular Formula | C21H18ClN2O4P |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | [1-(7-chloro-1-methylindol-3-yl)-2-(naphthalen-2-ylamino)-2-oxoethyl]phosphonic acid |
| SMILES | Cn1cc(C(C(=O)Nc2ccc3ccccc3c2)P(=O)(O)O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C21H18ClN2O4P/c1-24-12-17(16-7-4-8-18(22)19(16)24)20(29(26,27)28)21(25)23-15-10-9-13-5-2-3-6-14(13)11-15/h2-12,20H,1H3,(H,23,25)(H2,26,27,28) |
| InChIKey | VMBXBNVLHZJJBW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|