C17H12ClFN2O2 — CID 43831923
8-chloro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide (PubChem CID 43831923) has the molecular formula C17H12ClFN2O2 and a molecular weight of 330.75 g/mol. Its IUPAC name is 8-chloro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 8-chloro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 43831923 |
| Molecular Formula | C17H12ClFN2O2 |
| Molecular Weight | 330.75 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 8-chloro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(F)cc2)c(=O)c2cccc(Cl)c21 |
| InChI | InChI=1S/C17H12ClFN2O2/c1-21-9-13(16(22)12-3-2-4-14(18)15(12)21)17(23)20-11-7-5-10(19)6-8-11/h2-9H,1H3,(H,20,23) |
| InChIKey | VPMKZRGLGATXOK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |