C17H12F2N2O2 — CID 30133220
6-fluoro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide (PubChem CID 30133220) has the molecular formula C17H12F2N2O2 and a molecular weight of 314.29 g/mol. Its IUPAC name is 6-fluoro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-fluoro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 30133220 |
| Molecular Formula | C17H12F2N2O2 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-fluoro-N-(4-fluorophenyl)-1-methyl-4-oxoquinoline-3-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(F)cc2)c(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C17H12F2N2O2/c1-21-9-14(16(22)13-8-11(19)4-7-15(13)21)17(23)20-12-5-2-10(18)3-6-12/h2-9H,1H3,(H,20,23) |
| InChIKey | OZIQDHXYJLQROE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |