C20H20ClN2O+ — CID 7999379
(2-chlorophenyl)methyl-[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]azanium (PubChem CID 7999379) has the molecular formula C20H20ClN2O+ and a molecular weight of 339.85 g/mol. Its IUPAC name is (2-chlorophenyl)methyl-[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]azanium.
| Compound Name | (2-chlorophenyl)methyl-[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 7999379 |
| Molecular Formula | C20H20ClN2O+ |
| Molecular Weight | 339.85 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2-chlorophenyl)methyl-[(2R)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@@H]([NH2+]Cc1ccccc1Cl)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H19ClN2O/c1-14(22-13-17-8-4-5-9-19(17)21)20(24)23-18-11-10-15-6-2-3-7-16(15)12-18/h2-12,14,22H,13H2,1H3,(H,23,24)/p+1/t14-/m1/s1 |
| InChIKey | YAGJQDSXUFHQRQ-CQSZACIVSA-O |
| XLogP | 3.58 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |