C27H29N5O2S — CID 10228079
N-[3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]-4-(methylcarbamothioylamino)butanamide (PubChem CID 10228079) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]-4-(methylcarbamothioylamino)butanamide.
| Compound Name | N-[3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]-4-(methylcarbamothioylamino)butanamide |
|---|---|
| PubChem CID | 10228079 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[3-(1H-indol-3-yl)-1-(naphthalen-2-ylamino)-1-oxopropan-2-yl]-4-(methylcarbamothioylamino)butanamide |
| SMILES | CNC(=S)NCCCC(=O)NC(Cc1c[nH]c2ccccc12)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H29N5O2S/c1-28-27(35)29-14-6-11-25(33)32-24(16-20-17-30-23-10-5-4-9-22(20)23)26(34)31-21-13-12-18-7-2-3-8-19(18)15-21/h2-5,7-10,12-13,15,17,24,30H,6,11,14,16H2,1H3,(H,31,34)(H,32,33)(H2,28,29,35) |
| InChIKey | QFMXBHMMGZWJKS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|