C21H29N3O6 — CID 166514717
(2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 166514717) has the molecular formula C21H29N3O6 and a molecular weight of 419.48 g/mol. Its IUPAC name is (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 166514717 |
| Molecular Formula | C21H29N3O6 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H29N3O6/c1-21(2,12-25)18(27)19(28)22-9-5-8-17(26)24-16(20(29)30)10-13-11-23-15-7-4-3-6-14(13)15/h3-4,6-7,11,16,18,23,25,27H,5,8-10,12H2,1-2H3,(H,22,28)(H,24,26)(H,29,30)/t16-,18-/m0/s1 |
| InChIKey | KEMIGROILYVPLB-WMZOPIPTSA-N |
| XLogP | 0.56 |
| TPSA | 151.75 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|