C21H31N3O5 — CID 175800648
(2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 175800648) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 175800648 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (2S)-2-[4-[[(2R)-2,4-dihydroxy-3,3-dimethylbutyl]amino]butanoylamino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)(CO)[C@@H](O)CNCCCC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H31N3O5/c1-21(2,13-25)18(26)12-22-9-5-8-19(27)24-17(20(28)29)10-14-11-23-16-7-4-3-6-15(14)16/h3-4,6-7,11,17-18,22-23,25-26H,5,8-10,12-13H2,1-2H3,(H,24,27)(H,28,29)/t17-,18-/m0/s1 |
| InChIKey | KVOCADCISVRODR-ROUUACIJSA-N |
| XLogP | 1.03 |
| TPSA | 134.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|