C18H24N4O4S — CID 175713689
(2S)-2-[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid (PubChem CID 175713689) has the molecular formula C18H24N4O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is (2S)-2-[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid.
| Compound Name | (2S)-2-[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 175713689 |
| Molecular Formula | C18H24N4O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2S)-2-[4-[[(2S)-2-amino-3-(1H-indol-3-yl)propanoyl]amino]butanoylamino]-3-sulfanylpropanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)NCCCC(=O)N[C@H](CS)C(=O)O |
| InChI | InChI=1S/C18H24N4O4S/c19-13(8-11-9-21-14-5-2-1-4-12(11)14)17(24)20-7-3-6-16(23)22-15(10-27)18(25)26/h1-2,4-5,9,13,15,21,27H,3,6-8,10,19H2,(H,20,24)(H,22,23)(H,25,26)/t13-,15+/m0/s1 |
| InChIKey | UDXLXHHOGHYJDA-DZGCQCFKSA-N |
| XLogP | 0.43 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|