C18H25N2O6P — CID 66623056
6-dimethoxyphosphoryloxyhexyl N-isoquinolin-3-ylcarbamate (PubChem CID 66623056) has the molecular formula C18H25N2O6P and a molecular weight of 396.38 g/mol. Its IUPAC name is 6-dimethoxyphosphoryloxyhexyl N-isoquinolin-3-ylcarbamate.
| Compound Name | 6-dimethoxyphosphoryloxyhexyl N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 66623056 |
| Molecular Formula | C18H25N2O6P |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 6-dimethoxyphosphoryloxyhexyl N-isoquinolin-3-ylcarbamate |
| SMILES | COP(=O)(OC)OCCCCCCOC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C18H25N2O6P/c1-23-27(22,24-2)26-12-8-4-3-7-11-25-18(21)20-17-13-15-9-5-6-10-16(15)14-19-17/h5-6,9-10,13-14H,3-4,7-8,11-12H2,1-2H3,(H,19,20,21) |
| InChIKey | PEIZNQDJTWYDEQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|