C29H37ClFN6O8P — CID 66622717
[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(2-dimethoxyphosphoryloxyethylcarbamoylamino)pentyl] N-isoquinolin-3-ylcarbamate (PubChem CID 66622717) has the molecular formula C29H37ClFN6O8P and a molecular weight of 683.07 g/mol. Its IUPAC name is [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(2-dimethoxyphosphoryloxyethylcarbamoylamino)pentyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(2-dimethoxyphosphoryloxyethylcarbamoylamino)pentyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 66622717 |
| Molecular Formula | C29H37ClFN6O8P |
| Molecular Weight | 683.07 g/mol |
| Exact Mass | 682.21 |
| IUPAC Name | [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-5-(2-dimethoxyphosphoryloxyethylcarbamoylamino)pentyl] N-isoquinolin-3-ylcarbamate |
| SMILES | COP(=O)(OC)OCCNC(=O)NCCC[C@@H](COC(=O)Nc1cc2ccccc2cn1)N(NCc1cccc(F)c1Cl)C(C)=O |
| InChI | InChI=1S/C29H37ClFN6O8P/c1-20(38)37(35-18-23-10-6-12-25(31)27(23)30)24(11-7-13-32-28(39)33-14-15-45-46(41,42-2)43-3)19-44-29(40)36-26-16-21-8-4-5-9-22(21)17-34-26/h4-6,8-10,12,16-17,24,35H,7,11,13-15,18-19H2,1-3H3,(H2,32,33,39)(H,34,36,40)/t24-/m0/s1 |
| InChIKey | YGZWQRMZLIEEOB-DEOSSOPVSA-N |
| XLogP | 4.99 |
| TPSA | 169.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.07 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|