C30H36ClF2N5O5 — CID 66622635
[(5S)-5-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-6-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]hexyl] (2R)-2-amino-3-methylbutanoate (PubChem CID 66622635) has the molecular formula C30H36ClF2N5O5 and a molecular weight of 620.10 g/mol. Its IUPAC name is [(5S)-5-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-6-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]hexyl] (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(5S)-5-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-6-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]hexyl] (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 66622635 |
| Molecular Formula | C30H36ClF2N5O5 |
| Molecular Weight | 620.10 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | [(5S)-5-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-6-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]hexyl] (2R)-2-amino-3-methylbutanoate |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CCCCOC(=O)[C@H](N)C(C)C)COC(=O)Nc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C30H36ClF2N5O5/c1-18(2)28(34)29(40)42-12-5-4-8-24(38(19(3)39)36-16-21-7-6-9-25(33)27(21)31)17-43-30(41)37-26-14-22-13-23(32)11-10-20(22)15-35-26/h6-7,9-11,13-15,18,24,28,36H,4-5,8,12,16-17,34H2,1-3H3,(H,35,37,41)/t24-,28+/m0/s1 |
| InChIKey | BKHYSGZZYRHTKO-RBJSKKJNSA-N |
| XLogP | 5.33 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.10 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|