C29H35ClF2N6O5 — CID 163632241
[(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-6-(3-hydroxypropylcarbamoylamino)hexyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 163632241) has the molecular formula C29H35ClF2N6O5 and a molecular weight of 621.09 g/mol. Its IUPAC name is [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-6-(3-hydroxypropylcarbamoylamino)hexyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-6-(3-hydroxypropylcarbamoylamino)hexyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 163632241 |
| Molecular Formula | C29H35ClF2N6O5 |
| Molecular Weight | 621.09 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-6-(3-hydroxypropylcarbamoylamino)hexyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)[C@@H](CCCCNC(=O)NCCCO)COC(=O)Nc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C29H35ClF2N6O5/c1-38(28(41)36-17-20-6-4-8-24(32)26(20)30)23(7-2-3-11-33-27(40)34-12-5-13-39)18-43-29(42)37-25-15-21-14-22(31)10-9-19(21)16-35-25/h4,6,8-10,14-16,23,39H,2-3,5,7,11-13,17-18H2,1H3,(H,36,41)(H2,33,34,40)(H,35,37,42)/t23-/m0/s1 |
| InChIKey | HXDIKEBKOPOEMG-QHCPKHFHSA-N |
| XLogP | 4.78 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.09 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|