C25H22ClF4N5O4 — CID 140542279
[(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-4,4-difluoro-5-isocyanatopentyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 140542279) has the molecular formula C25H22ClF4N5O4 and a molecular weight of 567.93 g/mol. Its IUPAC name is [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-4,4-difluoro-5-isocyanatopentyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-4,4-difluoro-5-isocyanatopentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 140542279 |
| Molecular Formula | C25H22ClF4N5O4 |
| Molecular Weight | 567.93 g/mol |
| Exact Mass | 567.13 |
| IUPAC Name | [(2S)-2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]-4,4-difluoro-5-isocyanatopentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CN(C(=O)NCc1cccc(F)c1Cl)[C@H](COC(=O)Nc1cc2cc(F)ccc2cn1)CC(F)(F)CN=C=O |
| InChI | InChI=1S/C25H22ClF4N5O4/c1-35(23(37)33-11-16-3-2-4-20(28)22(16)26)19(9-25(29,30)13-31-14-36)12-39-24(38)34-21-8-17-7-18(27)6-5-15(17)10-32-21/h2-8,10,19H,9,11-13H2,1H3,(H,33,37)(H,32,34,38)/t19-/m0/s1 |
| InChIKey | MJWNPJADQKOYEX-IBGZPJMESA-N |
| XLogP | 5.29 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.93 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|