C24H23ClF2N4O3 — CID 66622139
2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]pent-4-enyl N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 66622139) has the molecular formula C24H23ClF2N4O3 and a molecular weight of 488.92 g/mol. Its IUPAC name is 2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]pent-4-enyl N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | 2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]pent-4-enyl N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 66622139 |
| Molecular Formula | C24H23ClF2N4O3 |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[(2-chloro-3-fluorophenyl)methylcarbamoyl-methylamino]pent-4-enyl N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | C=CCC(COC(=O)Nc1cc2cc(F)ccc2cn1)N(C)C(=O)NCc1cccc(F)c1Cl |
| InChI | InChI=1S/C24H23ClF2N4O3/c1-3-5-19(31(2)23(32)29-13-16-6-4-7-20(27)22(16)25)14-34-24(33)30-21-11-17-10-18(26)9-8-15(17)12-28-21/h3-4,6-12,19H,1,5,13-14H2,2H3,(H,29,32)(H,28,30,33) |
| InChIKey | XVOKFVSAAOSLLK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|