C26H28F3N3O4 — CID 152940893
[(2S)-2-[3-(2,3-difluorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 152940893) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is [(2S)-2-[3-(2,3-difluorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S)-2-[3-(2,3-difluorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 152940893 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | [(2S)-2-[3-(2,3-difluorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CN(C(=O)CCc1cccc(F)c1F)[C@@H](CCCCO)COC(=O)Nc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C26H28F3N3O4/c1-32(24(34)11-9-17-5-4-7-22(28)25(17)29)21(6-2-3-12-33)16-36-26(35)31-23-14-19-13-20(27)10-8-18(19)15-30-23/h4-5,7-8,10,13-15,21,33H,2-3,6,9,11-12,16H2,1H3,(H,30,31,35)/t21-/m0/s1 |
| InChIKey | UMTYNBKUSDADIR-NRFANRHFSA-N |
| XLogP | 4.82 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|