C26H29ClF2N6O3 — CID 161411236
[(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-5-(diaminomethylideneamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 161411236) has the molecular formula C26H29ClF2N6O3 and a molecular weight of 547.01 g/mol. Its IUPAC name is [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-5-(diaminomethylideneamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-5-(diaminomethylideneamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 161411236 |
| Molecular Formula | C26H29ClF2N6O3 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-5-(diaminomethylideneamino)pentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CN(C(=O)CCc1cccc(F)c1Cl)[C@@H](CCCN=C(N)N)COC(=O)Nc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C26H29ClF2N6O3/c1-35(23(36)10-8-16-4-2-6-21(29)24(16)27)20(5-3-11-32-25(30)31)15-38-26(37)34-22-13-18-12-19(28)9-7-17(18)14-33-22/h2,4,6-7,9,12-14,20H,3,5,8,10-11,15H2,1H3,(H4,30,31,32)(H,33,34,37)/t20-/m0/s1 |
| InChIKey | VVMNTSKFKQBBDD-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 135.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|