C25H26F3N6O3+ — CID 158122888
[(4S)-4-[3-(2,3-difluorophenyl)propanoyl-methylamino]-5-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]pentyl]imino-iminoazanium (PubChem CID 158122888) has the molecular formula C25H26F3N6O3+ and a molecular weight of 515.52 g/mol. Its IUPAC name is [(4S)-4-[3-(2,3-difluorophenyl)propanoyl-methylamino]-5-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]pentyl]imino-iminoazanium.
| Compound Name | [(4S)-4-[3-(2,3-difluorophenyl)propanoyl-methylamino]-5-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]pentyl]imino-iminoazanium |
|---|---|
| PubChem CID | 158122888 |
| Molecular Formula | C25H26F3N6O3+ |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | [(4S)-4-[3-(2,3-difluorophenyl)propanoyl-methylamino]-5-[(6-fluoroisoquinolin-3-yl)carbamoyloxy]pentyl]imino-iminoazanium |
| SMILES | CN(C(=O)CCc1cccc(F)c1F)[C@@H](CCCN=[N+]=N)COC(=O)Nc1cc2cc(F)ccc2cn1 |
| InChI | InChI=1S/C25H25F3N6O3/c1-34(23(35)10-8-16-4-2-6-21(27)24(16)28)20(5-3-11-31-33-29)15-37-25(36)32-22-13-18-12-19(26)9-7-17(18)14-30-22/h2,4,6-7,9,12-14,20,29H,3,5,8,10-11,15H2,1H3/p+1/t20-/m0/s1 |
| InChIKey | GBJCSMHZIBFZBA-FQEVSTJZSA-O |
| XLogP | 4.99 |
| TPSA | 121.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|