C26H30ClN3O4 — CID 153078575
[(2R)-2-[3-(2-chlorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-isoquinolin-3-ylcarbamate (PubChem CID 153078575) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is [(2R)-2-[3-(2-chlorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2R)-2-[3-(2-chlorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 153078575 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | [(2R)-2-[3-(2-chlorophenyl)propanoyl-methylamino]-6-hydroxyhexyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CN(C(=O)CCc1ccccc1Cl)[C@H](CCCCO)COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C26H30ClN3O4/c1-30(25(32)14-13-19-8-4-5-12-23(19)27)22(11-6-7-15-31)18-34-26(33)29-24-16-20-9-2-3-10-21(20)17-28-24/h2-5,8-10,12,16-17,22,31H,6-7,11,13-15,18H2,1H3,(H,28,29,33)/t22-/m1/s1 |
| InChIKey | VMUUORRPGHCMJX-JOCHJYFZSA-N |
| XLogP | 5.06 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|