C29H35ClN2O3 — CID 143764186
[(2R)-9-(2-chlorophenyl)-3-methyl-6-oxo-2-propan-2-ylnonyl] N-isoquinolin-3-ylcarbamate (PubChem CID 143764186) has the molecular formula C29H35ClN2O3 and a molecular weight of 495.06 g/mol. Its IUPAC name is [(2R)-9-(2-chlorophenyl)-3-methyl-6-oxo-2-propan-2-ylnonyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2R)-9-(2-chlorophenyl)-3-methyl-6-oxo-2-propan-2-ylnonyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 143764186 |
| Molecular Formula | C29H35ClN2O3 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.23 |
| IUPAC Name | [(2R)-9-(2-chlorophenyl)-3-methyl-6-oxo-2-propan-2-ylnonyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CC(C)[C@@H](COC(=O)Nc1cc2ccccc2cn1)C(C)CCC(=O)CCCc1ccccc1Cl |
| InChI | InChI=1S/C29H35ClN2O3/c1-20(2)26(19-35-29(34)32-28-17-23-10-4-5-11-24(23)18-31-28)21(3)15-16-25(33)13-8-12-22-9-6-7-14-27(22)30/h4-7,9-11,14,17-18,20-21,26H,8,12-13,15-16,19H2,1-3H3,(H,31,32,34)/t21?,26-/m1/s1 |
| InChIKey | ZSWKAHPNEMBVTD-ZTDHTWSHSA-N |
| XLogP | 7.72 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |