C23H25ClN4O3 — CID 76654859
2-[(2-chlorophenyl)methylcarbamoyl-methylamino]butyl N-isoquinolin-3-ylcarbamate (PubChem CID 76654859) has the molecular formula C23H25ClN4O3 and a molecular weight of 440.93 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]butyl N-isoquinolin-3-ylcarbamate.
| Compound Name | 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]butyl N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 76654859 |
| Molecular Formula | C23H25ClN4O3 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[(2-chlorophenyl)methylcarbamoyl-methylamino]butyl N-isoquinolin-3-ylcarbamate |
| SMILES | CCC(COC(=O)Nc1cc2ccccc2cn1)N(C)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C23H25ClN4O3/c1-3-19(28(2)22(29)26-14-18-10-6-7-11-20(18)24)15-31-23(30)27-21-12-16-8-4-5-9-17(16)13-25-21/h4-13,19H,3,14-15H2,1-2H3,(H,26,29)(H,25,27,30) |
| InChIKey | IADMMIDIFDJKFY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |