C22H23ClN4O4 — CID 140542348
[(1S)-3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-1-hydroxypropyl] N-isoquinolin-3-ylcarbamate (PubChem CID 140542348) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is [(1S)-3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-1-hydroxypropyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(1S)-3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-1-hydroxypropyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 140542348 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | [(1S)-3-[(2-chlorophenyl)methylcarbamoyl-methylamino]-1-hydroxypropyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CN(CC[C@@H](O)OC(=O)Nc1cc2ccccc2cn1)C(=O)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN4O4/c1-27(21(29)25-14-17-8-4-5-9-18(17)23)11-10-20(28)31-22(30)26-19-12-15-6-2-3-7-16(15)13-24-19/h2-9,12-13,20,28H,10-11,14H2,1H3,(H,25,29)(H,24,26,30)/t20-/m0/s1 |
| InChIKey | IWUSQMOUBMHFFS-FQEVSTJZSA-N |
| XLogP | 3.99 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|