C24H25F2N4Na2O8P — CID 66622512
disodium;[(2S,4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-2-hydroxy-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] phosphate (PubChem CID 66622512) has the molecular formula C24H25F2N4Na2O8P and a molecular weight of 612.43 g/mol. Its IUPAC name is disodium;[(2S,4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-2-hydroxy-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] phosphate.
| Compound Name | disodium;[(2S,4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-2-hydroxy-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] phosphate |
|---|---|
| PubChem CID | 66622512 |
| Molecular Formula | C24H25F2N4Na2O8P |
| Molecular Weight | 612.43 g/mol |
| Exact Mass | 612.12 |
| IUPAC Name | disodium;[(2S,4S)-4-[(2,3-difluorophenyl)methylcarbamoyl-methylamino]-2-hydroxy-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] phosphate |
| SMILES | CN(C(=O)NCc1cccc(F)c1F)[C@H](COC(=O)Nc1cc2ccccc2cn1)C[C@H](O)COP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C24H27F2N4O8P.2Na/c1-30(23(32)28-12-17-7-4-8-20(25)22(17)26)18(10-19(31)14-38-39(34,35)36)13-37-24(33)29-21-9-15-5-2-3-6-16(15)11-27-21;;/h2-9,11,18-19,31H,10,12-14H2,1H3,(H,28,32)(H,27,29,33)(H2,34,35,36);;/q;2*+1/p-2/t18-,19-;;/m0../s1 |
| InChIKey | OOFMFKUFZTWLDH-JYRWABTFSA-L |
| XLogP | -4.12 |
| TPSA | 176.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.43 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|