C25H29F2N4O7P — CID 66622211
[(2R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-6-phosphonooxyhexyl] N-isoquinolin-3-ylcarbamate (PubChem CID 66622211) has the molecular formula C25H29F2N4O7P and a molecular weight of 566.50 g/mol. Its IUPAC name is [(2R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-6-phosphonooxyhexyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-6-phosphonooxyhexyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 66622211 |
| Molecular Formula | C25H29F2N4O7P |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 566.17 |
| IUPAC Name | [(2R)-2-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-6-phosphonooxyhexyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CC(=O)N(NCc1cccc(F)c1F)[C@H](CCCCOP(=O)(O)O)COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C25H29F2N4O7P/c1-17(32)31(29-15-20-9-6-11-22(26)24(20)27)21(10-4-5-12-38-39(34,35)36)16-37-25(33)30-23-13-18-7-2-3-8-19(18)14-28-23/h2-3,6-9,11,13-14,21,29H,4-5,10,12,15-16H2,1H3,(H,28,30,33)(H2,34,35,36)/t21-/m1/s1 |
| InChIKey | LYEKTONLAWWBBE-OAQYLSRUSA-N |
| XLogP | 4.26 |
| TPSA | 150.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|