C24H27ClFN5O4 — CID 140542293
[(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate (PubChem CID 140542293) has the molecular formula C24H27ClFN5O4 and a molecular weight of 503.96 g/mol. Its IUPAC name is [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 140542293 |
| Molecular Formula | C24H27ClFN5O4 |
| Molecular Weight | 503.96 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | [(2S)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@@H](CNCCO)COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C24H27ClFN5O4/c1-16(33)31(29-13-19-7-4-8-21(26)23(19)25)20(14-27-9-10-32)15-35-24(34)30-22-11-17-5-2-3-6-18(17)12-28-22/h2-8,11-12,20,27,29,32H,9-10,13-15H2,1H3,(H,28,30,34)/t20-/m0/s1 |
| InChIKey | UESZZPMVDWUWSO-FQEVSTJZSA-N |
| XLogP | 3.08 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.96 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|