C25H28ClFN4O4 — CID 147705452
[(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate (PubChem CID 147705452) has the molecular formula C25H28ClFN4O4 and a molecular weight of 502.97 g/mol. Its IUPAC name is [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate.
| Compound Name | [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate |
|---|---|
| PubChem CID | 147705452 |
| Molecular Formula | C25H28ClFN4O4 |
| Molecular Weight | 502.97 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | [(2S)-2-[3-(2-chloro-3-fluorophenyl)propanoyl-methylamino]-3-(2-hydroxyethylamino)propyl] N-isoquinolin-3-ylcarbamate |
| SMILES | CN(C(=O)CCc1cccc(F)c1Cl)[C@@H](CNCCO)COC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C25H28ClFN4O4/c1-31(23(33)10-9-17-7-4-8-21(27)24(17)26)20(15-28-11-12-32)16-35-25(34)30-22-13-18-5-2-3-6-19(18)14-29-22/h2-8,13-14,20,28,32H,9-12,15-16H2,1H3,(H,29,30,34)/t20-/m0/s1 |
| InChIKey | GTRKDESICSOHHZ-FQEVSTJZSA-N |
| XLogP | 3.62 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.97 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|