C26H28F2N4O5 — CID 66622114
[4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] acetate (PubChem CID 66622114) has the molecular formula C26H28F2N4O5 and a molecular weight of 514.53 g/mol. Its IUPAC name is [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] acetate.
| Compound Name | [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] acetate |
|---|---|
| PubChem CID | 66622114 |
| Molecular Formula | C26H28F2N4O5 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | [4-[acetyl-[(2,3-difluorophenyl)methylamino]amino]-5-(isoquinolin-3-ylcarbamoyloxy)pentyl] acetate |
| SMILES | CC(=O)OCCCC(COC(=O)Nc1cc2ccccc2cn1)N(NCc1cccc(F)c1F)C(C)=O |
| InChI | InChI=1S/C26H28F2N4O5/c1-17(33)32(30-15-21-9-5-11-23(27)25(21)28)22(10-6-12-36-18(2)34)16-37-26(35)31-24-13-19-7-3-4-8-20(19)14-29-24/h3-5,7-9,11,13-14,22,30H,6,10,12,15-16H2,1-2H3,(H,29,31,35) |
| InChIKey | AGVHTALLQUGRJM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|