C24H26ClF2N4O8P — CID 66622577
[(2S,4R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4-hydroxy-5-phosphonooxypentyl] N-(6-fluoroisoquinolin-3-yl)carbamate (PubChem CID 66622577) has the molecular formula C24H26ClF2N4O8P and a molecular weight of 602.92 g/mol. Its IUPAC name is [(2S,4R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4-hydroxy-5-phosphonooxypentyl] N-(6-fluoroisoquinolin-3-yl)carbamate.
| Compound Name | [(2S,4R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4-hydroxy-5-phosphonooxypentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
|---|---|
| PubChem CID | 66622577 |
| Molecular Formula | C24H26ClF2N4O8P |
| Molecular Weight | 602.92 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | [(2S,4R)-2-[acetyl-[(2-chloro-3-fluorophenyl)methylamino]amino]-4-hydroxy-5-phosphonooxypentyl] N-(6-fluoroisoquinolin-3-yl)carbamate |
| SMILES | CC(=O)N(NCc1cccc(F)c1Cl)[C@H](COC(=O)Nc1cc2cc(F)ccc2cn1)C[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C24H26ClF2N4O8P/c1-14(32)31(29-11-16-3-2-4-21(27)23(16)25)19(9-20(33)13-39-40(35,36)37)12-38-24(34)30-22-8-17-7-18(26)6-5-15(17)10-28-22/h2-8,10,19-20,29,33H,9,11-13H2,1H3,(H,28,30,34)(H2,35,36,37)/t19-,20+/m0/s1 |
| InChIKey | VQGVPNKQIIOIOO-VQTJNVASSA-N |
| XLogP | 3.50 |
| TPSA | 170.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.92 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|