C20H27N3O4 — CID 140542333
6-(isoquinolin-3-ylcarbamoyloxy)hexyl 2-(dimethylamino)acetate (PubChem CID 140542333) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 6-(isoquinolin-3-ylcarbamoyloxy)hexyl 2-(dimethylamino)acetate.
| Compound Name | 6-(isoquinolin-3-ylcarbamoyloxy)hexyl 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 140542333 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 6-(isoquinolin-3-ylcarbamoyloxy)hexyl 2-(dimethylamino)acetate |
| SMILES | CN(C)CC(=O)OCCCCCCOC(=O)Nc1cc2ccccc2cn1 |
| InChI | InChI=1S/C20H27N3O4/c1-23(2)15-19(24)26-11-7-3-4-8-12-27-20(25)22-18-13-16-9-5-6-10-17(16)14-21-18/h5-6,9-10,13-14H,3-4,7-8,11-12,15H2,1-2H3,(H,21,22,25) |
| InChIKey | JYZSTMRAZBSTSK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|