C13H17NO6P2 — CID 20776509
[naphthalen-2-ylmethyl(phosphonomethyl)amino]methylphosphonic acid (PubChem CID 20776509) has the molecular formula C13H17NO6P2 and a molecular weight of 345.23 g/mol. Its IUPAC name is [naphthalen-2-ylmethyl(phosphonomethyl)amino]methylphosphonic acid.
| Compound Name | [naphthalen-2-ylmethyl(phosphonomethyl)amino]methylphosphonic acid |
|---|---|
| PubChem CID | 20776509 |
| Molecular Formula | C13H17NO6P2 |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | [naphthalen-2-ylmethyl(phosphonomethyl)amino]methylphosphonic acid |
| SMILES | O=P(O)(O)CN(Cc1ccc2ccccc2c1)CP(=O)(O)O |
| InChI | InChI=1S/C13H17NO6P2/c15-21(16,17)9-14(10-22(18,19)20)8-11-5-6-12-3-1-2-4-13(12)7-11/h1-7H,8-10H2,(H2,15,16,17)(H2,18,19,20) |
| InChIKey | GQQBAEKIPHBCFW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|