C19H26NO4P — CID 139552200
[3-[[(3-ethylphenyl)methyl-(2-hydroxyethyl)amino]methyl]phenyl]methylphosphonic acid (PubChem CID 139552200) has the molecular formula C19H26NO4P and a molecular weight of 363.39 g/mol. Its IUPAC name is [3-[[(3-ethylphenyl)methyl-(2-hydroxyethyl)amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [3-[[(3-ethylphenyl)methyl-(2-hydroxyethyl)amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 139552200 |
| Molecular Formula | C19H26NO4P |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [3-[[(3-ethylphenyl)methyl-(2-hydroxyethyl)amino]methyl]phenyl]methylphosphonic acid |
| SMILES | CCc1cccc(CN(CCO)Cc2cccc(CP(=O)(O)O)c2)c1 |
| InChI | InChI=1S/C19H26NO4P/c1-2-16-5-3-6-17(11-16)13-20(9-10-21)14-18-7-4-8-19(12-18)15-25(22,23)24/h3-8,11-12,21H,2,9-10,13-15H2,1H3,(H2,22,23,24) |
| InChIKey | YIUWEJSEERGMPN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|