C26H43FN2O — CID 143170289
butane;2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]-3-fluorophenol;ethane (PubChem CID 143170289) has the molecular formula C26H43FN2O and a molecular weight of 418.64 g/mol. Its IUPAC name is butane;2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]-3-fluorophenol;ethane.
| Compound Name | butane;2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]-3-fluorophenol;ethane |
|---|---|
| PubChem CID | 143170289 |
| Molecular Formula | C26H43FN2O |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | butane;2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]-3-fluorophenol;ethane |
| SMILES | CC.CCCC.CCc1cccc(CN(CCN(C)C)Cc2c(O)cccc2F)c1 |
| InChI | InChI=1S/C20H27FN2O.C4H10.C2H6/c1-4-16-7-5-8-17(13-16)14-23(12-11-22(2)3)15-18-19(21)9-6-10-20(18)24;1-3-4-2;1-2/h5-10,13,24H,4,11-12,14-15H2,1-3H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | RTBSKUKJJWMBEH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|