C22H38N2 — CID 143169947
N'-(cyclohexen-1-ylmethyl)-N'-[(3-ethylphenyl)methyl]-N,N-dimethylethane-1,2-diamine;ethane (PubChem CID 143169947) has the molecular formula C22H38N2 and a molecular weight of 330.56 g/mol. Its IUPAC name is N'-(cyclohexen-1-ylmethyl)-N'-[(3-ethylphenyl)methyl]-N,N-dimethylethane-1,2-diamine;ethane.
| Compound Name | N'-(cyclohexen-1-ylmethyl)-N'-[(3-ethylphenyl)methyl]-N,N-dimethylethane-1,2-diamine;ethane |
|---|---|
| PubChem CID | 143169947 |
| Molecular Formula | C22H38N2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.30 |
| IUPAC Name | N'-(cyclohexen-1-ylmethyl)-N'-[(3-ethylphenyl)methyl]-N,N-dimethylethane-1,2-diamine;ethane |
| SMILES | CC.CCc1cccc(CN(CCN(C)C)CC2=CCCCC2)c1 |
| InChI | InChI=1S/C20H32N2.C2H6/c1-4-18-11-8-12-20(15-18)17-22(14-13-21(2)3)16-19-9-6-5-7-10-19;1-2/h8-9,11-12,15H,4-7,10,13-14,16-17H2,1-3H3;1-2H3 |
| InChIKey | JTWFUMGCNAGBPP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|