C23H33N3 — CID 143170148
2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]benzonitrile;ethane (PubChem CID 143170148) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]benzonitrile;ethane.
| Compound Name | 2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]benzonitrile;ethane |
|---|---|
| PubChem CID | 143170148 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | 2-[[2-(dimethylamino)ethyl-[(3-ethylphenyl)methyl]amino]methyl]benzonitrile;ethane |
| SMILES | CC.CCc1cccc(CN(CCN(C)C)Cc2ccccc2C#N)c1 |
| InChI | InChI=1S/C21H27N3.C2H6/c1-4-18-8-7-9-19(14-18)16-24(13-12-23(2)3)17-21-11-6-5-10-20(21)15-22;1-2/h5-11,14H,4,12-13,16-17H2,1-3H3;1-2H3 |
| InChIKey | LKZHPUYLQRPMFI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |