About (3,4-diaminophenyl)methanol;dihydrochloride
(3,4-diaminophenyl)methanol;dihydrochloride (PubChem CID 24721578) has the molecular formula C7H12Cl2N2O
and a molecular weight of 211.09 g/mol. Its IUPAC name is (3,4-diaminophenyl)methanol;dihydrochloride.
Molecular Properties
| Compound Name | (3,4-diaminophenyl)methanol;dihydrochloride |
| PubChem CID | 24721578 |
| Molecular Formula | C7H12Cl2N2O |
| Molecular Weight | 211.09 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | (3,4-diaminophenyl)methanol;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CO)cc1N |
| InChI | InChI=1S/C7H10N2O.2ClH/c8-6-2-1-5(4-10)3-7(6)9;;/h1-3,10H,4,8-9H2;2*1H |
| InChIKey | FEEVEFUWQDGMKI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.09 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (3,4-diaminophenyl)methanol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-diaminophenyl)methanol;dihydrochloride?
The IUPAC name of (3,4-diaminophenyl)methanol;dihydrochloride (CID 24721578) is (3,4-diaminophenyl)methanol;dihydrochloride.
What is the SMILES notation for (3,4-diaminophenyl)methanol;dihydrochloride?
The canonical SMILES for (3,4-diaminophenyl)methanol;dihydrochloride is Cl.Cl.Nc1ccc(CO)cc1N.
What is the InChIKey of (3,4-diaminophenyl)methanol;dihydrochloride?
The InChIKey is FEEVEFUWQDGMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O.2ClH/c8-6-2-1-5(4-10)3-7(6)9;;/h1-3,10H,4,8-9H2;2*1H.
What are the key properties of (3,4-diaminophenyl)methanol;dihydrochloride?
(3,4-diaminophenyl)methanol;dihydrochloride has a molecular weight of 211.09 g/mol, XLogP of 1.19, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diaminophenyl)methanol;dihydrochloride is sourced from PubChem (CID 24721578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).