About 1,1'-biphenyl cyanide
1,1'-biphenyl cyanide (PubChem CID 160660269) has the molecular formula C13H10N-
and a molecular weight of 180.23 g/mol. Its IUPAC name is 1,1'-biphenyl cyanide.
Molecular Properties
| Compound Name | 1,1'-biphenyl cyanide |
| PubChem CID | 160660269 |
| Molecular Formula | C13H10N- |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,1'-biphenyl cyanide |
| SMILES | [C-]#N.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.CN/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-10H;/q;-1 |
| InChIKey | RLOSRCUFYXDHPG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl cyanide?
The IUPAC name of 1,1'-biphenyl cyanide (CID 160660269) is 1,1'-biphenyl cyanide.
What is the SMILES notation for 1,1'-biphenyl cyanide?
The canonical SMILES for 1,1'-biphenyl cyanide is [C-]#N.c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl cyanide?
The InChIKey is RLOSRCUFYXDHPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.CN/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2/h1-10H;/q;-1.
What are the key properties of 1,1'-biphenyl cyanide?
1,1'-biphenyl cyanide has a molecular weight of 180.23 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl cyanide is sourced from PubChem (CID 160660269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).