About 1,1'-biphenyl;carbon monoxide;chromium
1,1'-biphenyl;carbon monoxide;chromium (PubChem CID 11066186) has the molecular formula C15H10CrO3
and a molecular weight of 290.24 g/mol. Its IUPAC name is 1,1'-biphenyl;carbon monoxide;chromium.
Molecular Properties
| Compound Name | 1,1'-biphenyl;carbon monoxide;chromium |
| PubChem CID | 11066186 |
| Molecular Formula | C15H10CrO3 |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 1,1'-biphenyl;carbon monoxide;chromium |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.3CO.Cr/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3*1-2;/h1-10H;;;; |
| InChIKey | PWGBRKPYZFGXFC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1,1'-biphenyl;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;carbon monoxide;chromium?
The IUPAC name of 1,1'-biphenyl;carbon monoxide;chromium (CID 11066186) is 1,1'-biphenyl;carbon monoxide;chromium.
What is the SMILES notation for 1,1'-biphenyl;carbon monoxide;chromium?
The canonical SMILES for 1,1'-biphenyl;carbon monoxide;chromium is [C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;carbon monoxide;chromium?
The InChIKey is PWGBRKPYZFGXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.3CO.Cr/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;3*1-2;/h1-10H;;;;.
What are the key properties of 1,1'-biphenyl;carbon monoxide;chromium?
1,1'-biphenyl;carbon monoxide;chromium has a molecular weight of 290.24 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;carbon monoxide;chromium is sourced from PubChem (CID 11066186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).