C19H13NS2 — CID 139640767
2,6-bis(phenylsulfanyl)benzonitrile (PubChem CID 139640767) has the molecular formula C19H13NS2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 2,6-bis(phenylsulfanyl)benzonitrile.
| Compound Name | 2,6-bis(phenylsulfanyl)benzonitrile |
|---|---|
| PubChem CID | 139640767 |
| Molecular Formula | C19H13NS2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2,6-bis(phenylsulfanyl)benzonitrile |
| SMILES | N#Cc1c(Sc2ccccc2)cccc1Sc1ccccc1 |
| InChI | InChI=1S/C19H13NS2/c20-14-17-18(21-15-8-3-1-4-9-15)12-7-13-19(17)22-16-10-5-2-6-11-16/h1-13H |
| InChIKey | LTCHHLRRLLYSFV-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |